C18H18ClN3O6S — CID 58653122
(2-chloro-4-nitrophenyl)-[(3S)-3-(hydroxymethyl)-4-methylsulfonyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl]methanone (PubChem CID 58653122) has the molecular formula C18H18ClN3O6S and a molecular weight of 439.88 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl)-[(3S)-3-(hydroxymethyl)-4-methylsulfonyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl]methanone.
| Compound Name | (2-chloro-4-nitrophenyl)-[(3S)-3-(hydroxymethyl)-4-methylsulfonyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl]methanone |
|---|---|
| PubChem CID | 58653122 |
| Molecular Formula | C18H18ClN3O6S |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | (2-chloro-4-nitrophenyl)-[(3S)-3-(hydroxymethyl)-4-methylsulfonyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl]methanone |
| SMILES | CS(=O)(=O)N1Cc2ccccc2N(C(=O)c2ccc([N+](=O)[O-])cc2Cl)C[C@H]1CO |
| InChI | InChI=1S/C18H18ClN3O6S/c1-29(27,28)21-9-12-4-2-3-5-17(12)20(10-14(21)11-23)18(24)15-7-6-13(22(25)26)8-16(15)19/h2-8,14,23H,9-11H2,1H3/t14-/m0/s1 |
| InChIKey | AJEOJLIVQOSOJW-AWEZNQCLSA-N |
| XLogP | 2.03 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|