C16H26F4 — CID 58665420
1-heptyl-4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexane (PubChem CID 58665420) has the molecular formula C16H26F4 and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-heptyl-4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexane.
| Compound Name | 1-heptyl-4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexane |
|---|---|
| PubChem CID | 58665420 |
| Molecular Formula | C16H26F4 |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 1-heptyl-4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexane |
| SMILES | CCCCCCCC1CCC(C=C(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H26F4/c1-2-3-4-5-6-7-13-8-10-14(11-9-13)12-15(17)16(18,19)20/h12-14H,2-11H2,1H3 |
| InChIKey | SHWYAAVQUUXBCR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|