C18H26F4 — CID 58665487
1-methyl-4-[(E)-2-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]ethenyl]cyclohexane (PubChem CID 58665487) has the molecular formula C18H26F4 and a molecular weight of 318.40 g/mol. Its IUPAC name is 1-methyl-4-[(E)-2-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]ethenyl]cyclohexane.
| Compound Name | 1-methyl-4-[(E)-2-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]ethenyl]cyclohexane |
|---|---|
| PubChem CID | 58665487 |
| Molecular Formula | C18H26F4 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 1-methyl-4-[(E)-2-[4-(2,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]ethenyl]cyclohexane |
| SMILES | CC1CCC(/C=C/C2CCC(C=C(F)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C18H26F4/c1-13-2-4-14(5-3-13)6-7-15-8-10-16(11-9-15)12-17(19)18(20,21)22/h6-7,12-16H,2-5,8-11H2,1H3/b7-6+,17-12? |
| InChIKey | NLAIOQKDLYURLD-OBXSZPLLSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|