C33H37N3O7 — CID 58668582
(2R)-N'-hydroxy-N-[(2S)-1-(1H-indol-3-yl)-1-oxo-3-phenylpropan-2-yl]-2-[3-(3,4,5-trimethoxyphenyl)propyl]butanediamide (PubChem CID 58668582) has the molecular formula C33H37N3O7 and a molecular weight of 587.67 g/mol. Its IUPAC name is (2R)-N'-hydroxy-N-[(2S)-1-(1H-indol-3-yl)-1-oxo-3-phenylpropan-2-yl]-2-[3-(3,4,5-trimethoxyphenyl)propyl]butanediamide.
| Compound Name | (2R)-N'-hydroxy-N-[(2S)-1-(1H-indol-3-yl)-1-oxo-3-phenylpropan-2-yl]-2-[3-(3,4,5-trimethoxyphenyl)propyl]butanediamide |
|---|---|
| PubChem CID | 58668582 |
| Molecular Formula | C33H37N3O7 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | (2R)-N'-hydroxy-N-[(2S)-1-(1H-indol-3-yl)-1-oxo-3-phenylpropan-2-yl]-2-[3-(3,4,5-trimethoxyphenyl)propyl]butanediamide |
| SMILES | COc1cc(CCC[C@H](CC(=O)NO)C(=O)N[C@@H](Cc2ccccc2)C(=O)c2c[nH]c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C33H37N3O7/c1-41-28-17-22(18-29(42-2)32(28)43-3)12-9-13-23(19-30(37)36-40)33(39)35-27(16-21-10-5-4-6-11-21)31(38)25-20-34-26-15-8-7-14-24(25)26/h4-8,10-11,14-15,17-18,20,23,27,34,40H,9,12-13,16,19H2,1-3H3,(H,35,39)(H,36,37)/t23-,27+/m1/s1 |
| InChIKey | UNKQTBXUUNLLHG-KCWPFWIISA-N |
| XLogP | 4.64 |
| TPSA | 138.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|