C16H14IrN3O3S2- — CID 58675873
iridium;2-(4-methylsulfanylbenzene-6-id-1-yl)pyridine;pyrimidine-4-sulfonic acid (PubChem CID 58675873) has the molecular formula C16H14IrN3O3S2- and a molecular weight of 552.66 g/mol. Its IUPAC name is iridium;2-(4-methylsulfanylbenzene-6-id-1-yl)pyridine;pyrimidine-4-sulfonic acid.
| Compound Name | iridium;2-(4-methylsulfanylbenzene-6-id-1-yl)pyridine;pyrimidine-4-sulfonic acid |
|---|---|
| PubChem CID | 58675873 |
| Molecular Formula | C16H14IrN3O3S2- |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | iridium;2-(4-methylsulfanylbenzene-6-id-1-yl)pyridine;pyrimidine-4-sulfonic acid |
| SMILES | CSc1c[c-]c(-c2ccccn2)cc1.O=S(=O)(O)c1ccncn1.[Ir] |
| InChI | InChI=1S/C12H10NS.C4H4N2O3S.Ir/c1-14-11-7-5-10(6-8-11)12-4-2-3-9-13-12;7-10(8,9)4-1-2-5-3-6-4;/h2-5,7-9H,1H3;1-3H,(H,7,8,9);/q-1;; |
| InChIKey | NOVZZFGBUDRTGZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|