C22H24N2O8 — CID 58676791
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-formyl-1,3,10,11,12a-pentahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide (PubChem CID 58676791) has the molecular formula C22H24N2O8 and a molecular weight of 444.44 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-formyl-1,3,10,11,12a-pentahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-formyl-1,3,10,11,12a-pentahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 58676791 |
| Molecular Formula | C22H24N2O8 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-formyl-1,3,10,11,12a-pentahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(O)=C(C(N)=O)C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C=O)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C22H24N2O8/c1-24(2)16-11-6-9-5-10-8(7-25)3-4-12(26)14(10)17(27)13(9)19(29)22(11,32)20(30)15(18(16)28)21(23)31/h3-4,7,9,11,16,20,26-28,30,32H,5-6H2,1-2H3,(H2,23,31)/t9-,11-,16-,20?,22-/m0/s1 |
| InChIKey | NEUNTJOLFKFOKF-MJCJRUIUSA-N |
| XLogP | -0.43 |
| TPSA | 181.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|