C26H30N2O6 — CID 118505032
7-(cyclobutylidenemethyl)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide (PubChem CID 118505032) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is 7-(cyclobutylidenemethyl)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide.
| Compound Name | 7-(cyclobutylidenemethyl)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 118505032 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 7-(cyclobutylidenemethyl)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(O)=C(C(N)=O)CC2(O)C(=O)C3=C(O)c4c(O)ccc(C=C5CCC5)c4CC3CC12 |
| InChI | InChI=1S/C26H30N2O6/c1-28(2)21-17-10-14-9-15-13(8-12-4-3-5-12)6-7-18(29)20(15)23(31)19(14)24(32)26(17,34)11-16(22(21)30)25(27)33/h6-8,14,17,21,29-31,34H,3-5,9-11H2,1-2H3,(H2,27,33) |
| InChIKey | XYAQDHHVCIYRRD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |