C25H26N2O7 — CID 118505068
4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-7-(3-oxobut-1-ynyl)-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide (PubChem CID 118505068) has the molecular formula C25H26N2O7 and a molecular weight of 466.49 g/mol. Its IUPAC name is 4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-7-(3-oxobut-1-ynyl)-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-7-(3-oxobut-1-ynyl)-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 118505068 |
| Molecular Formula | C25H26N2O7 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-7-(3-oxobut-1-ynyl)-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
| SMILES | CC(=O)C#Cc1ccc(O)c2c1CC1CC3C(N(C)C)C(O)=C(C(N)=O)CC3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H26N2O7/c1-11(28)4-5-12-6-7-17(29)19-14(12)8-13-9-16-20(27(2)3)21(30)15(24(26)33)10-25(16,34)23(32)18(13)22(19)31/h6-7,13,16,20,29-31,34H,8-10H2,1-3H3,(H2,26,33) |
| InChIKey | OENMTYWTMVWULD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|