C27H28N2O7S — CID 118505040
7-(3-acetylthiophen-2-yl)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide (PubChem CID 118505040) has the molecular formula C27H28N2O7S and a molecular weight of 524.60 g/mol. Its IUPAC name is 7-(3-acetylthiophen-2-yl)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide.
| Compound Name | 7-(3-acetylthiophen-2-yl)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 118505040 |
| Molecular Formula | C27H28N2O7S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 7-(3-acetylthiophen-2-yl)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-12-oxo-1,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
| SMILES | CC(=O)c1ccsc1-c1ccc(O)c2c1CC1CC3C(N(C)C)C(O)=C(C(N)=O)CC3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C27H28N2O7S/c1-11(30)13-6-7-37-24(13)14-4-5-18(31)20-15(14)8-12-9-17-21(29(2)3)22(32)16(26(28)35)10-27(17,36)25(34)19(12)23(20)33/h4-7,12,17,21,31-33,36H,8-10H2,1-3H3,(H2,28,35) |
| InChIKey | YRKUZRPIWVOZPR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |