C23H26IN3O6 — CID 58676889
(4R,12aS)-4,7-bis(dimethylamino)-10,11,12a-trihydroxy-9-iodo-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58676889) has the molecular formula C23H26IN3O6 and a molecular weight of 567.38 g/mol. Its IUPAC name is (4R,12aS)-4,7-bis(dimethylamino)-10,11,12a-trihydroxy-9-iodo-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,12aS)-4,7-bis(dimethylamino)-10,11,12a-trihydroxy-9-iodo-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58676889 |
| Molecular Formula | C23H26IN3O6 |
| Molecular Weight | 567.38 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | (4R,12aS)-4,7-bis(dimethylamino)-10,11,12a-trihydroxy-9-iodo-1,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(I)c(O)c2c1CC1CC3[C@H](N(C)C)C=C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C23H26IN3O6/c1-26(2)14-8-13(24)18(28)17-10(14)5-9-6-12-15(27(3)4)7-11(22(25)32)20(30)23(12,33)21(31)16(9)19(17)29/h7-9,12,15,28-29,33H,5-6H2,1-4H3,(H2,25,32)/t9?,12?,15-,23-/m1/s1 |
| InChIKey | NKTNECFDVOOAEI-OZZJHDFDSA-N |
| XLogP | 0.75 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|