C29H22Cl4O5 — CID 58679038
2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 58679038) has the molecular formula C29H22Cl4O5 and a molecular weight of 592.30 g/mol. Its IUPAC name is 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 58679038 |
| Molecular Formula | C29H22Cl4O5 |
| Molecular Weight | 592.30 g/mol |
| Exact Mass | 590.02 |
| IUPAC Name | 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | COc1ccc(C(OCc2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H22Cl4O5/c1-36-20-12-8-18(9-13-20)29(17-6-4-3-5-7-17,19-10-14-21(37-2)15-11-19)38-16-22-23(28(34)35)25(31)27(33)26(32)24(22)30/h3-15H,16H2,1-2H3,(H,34,35) |
| InChIKey | KERYCSAKESUIQE-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.30 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|