C25H31ClN2O2 — CID 58685214
2-(4-chlorophenyl)-2-methyl-N-(3-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylpropyl)propanamide (PubChem CID 58685214) has the molecular formula C25H31ClN2O2 and a molecular weight of 426.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-methyl-N-(3-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylpropyl)propanamide.
| Compound Name | 2-(4-chlorophenyl)-2-methyl-N-(3-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylpropyl)propanamide |
|---|---|
| PubChem CID | 58685214 |
| Molecular Formula | C25H31ClN2O2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-(4-chlorophenyl)-2-methyl-N-(3-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylpropyl)propanamide |
| SMILES | CC(C)(C(=O)NCCCN1CCC2(CC1)OCc1ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H31ClN2O2/c1-24(2,20-8-10-21(26)11-9-20)23(29)27-14-5-15-28-16-12-25(13-17-28)22-7-4-3-6-19(22)18-30-25/h3-4,6-11H,5,12-18H2,1-2H3,(H,27,29) |
| InChIKey | XYFICKNLAZBVOY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|