C18H26N2O4 — CID 58685968
[4-[2-(methylamino)-2-oxoethyl]phenyl]methyl 2-acetamido-4-methylpentanoate (PubChem CID 58685968) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is [4-[2-(methylamino)-2-oxoethyl]phenyl]methyl 2-acetamido-4-methylpentanoate.
| Compound Name | [4-[2-(methylamino)-2-oxoethyl]phenyl]methyl 2-acetamido-4-methylpentanoate |
|---|---|
| PubChem CID | 58685968 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [4-[2-(methylamino)-2-oxoethyl]phenyl]methyl 2-acetamido-4-methylpentanoate |
| SMILES | CNC(=O)Cc1ccc(COC(=O)C(CC(C)C)NC(C)=O)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-12(2)9-16(20-13(3)21)18(23)24-11-15-7-5-14(6-8-15)10-17(22)19-4/h5-8,12,16H,9-11H2,1-4H3,(H,19,22)(H,20,21) |
| InChIKey | VUEXQUMPWBLMMJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |