C21H20Cl2FN3O2 — CID 58688097
2-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]propan-2-ol (PubChem CID 58688097) has the molecular formula C21H20Cl2FN3O2 and a molecular weight of 436.31 g/mol. Its IUPAC name is 2-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]propan-2-ol.
| Compound Name | 2-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 58688097 |
| Molecular Formula | C21H20Cl2FN3O2 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-[5-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-2-pyridinyl]propan-2-ol |
| SMILES | CC(Oc1cc(-c2ccc(C(C)(C)O)nc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H20Cl2FN3O2/c1-11(18-14(22)5-6-15(24)19(18)23)29-16-8-13(10-27-20(16)25)12-4-7-17(26-9-12)21(2,3)28/h4-11,28H,1-3H3,(H2,25,27) |
| InChIKey | MPAIJTOGBQYNPW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|