C19H16Cl2FN3O2 — CID 58688145
[6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol (PubChem CID 58688145) has the molecular formula C19H16Cl2FN3O2 and a molecular weight of 408.26 g/mol. Its IUPAC name is [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol.
| Compound Name | [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 58688145 |
| Molecular Formula | C19H16Cl2FN3O2 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol |
| SMILES | CC(Oc1cc(-c2ccc(CO)cn2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C19H16Cl2FN3O2/c1-10(17-13(20)3-4-14(22)18(17)21)27-16-6-12(8-25-19(16)23)15-5-2-11(9-26)7-24-15/h2-8,10,26H,9H2,1H3,(H2,23,25) |
| InChIKey | YBBZPSPBLNETEF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|