About [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol
[6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol (PubChem CID 58688145) has the molecular formula C19H16Cl2FN3O2
and a molecular weight of 408.26 g/mol. Its IUPAC name is [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol |
| PubChem CID | 58688145 |
| Molecular Formula | C19H16Cl2FN3O2 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol |
| SMILES | CC(Oc1cc(-c2ccc(CO)cn2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C19H16Cl2FN3O2/c1-10(17-13(20)3-4-14(22)18(17)21)27-16-6-12(8-25-19(16)23)15-5-2-11(9-26)7-24-15/h2-8,10,26H,9H2,1H3,(H2,23,25) |
| InChIKey | YBBZPSPBLNETEF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol?
The IUPAC name of [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol (CID 58688145) is [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol.
What is the SMILES notation for [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol?
The canonical SMILES for [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol is CC(Oc1cc(-c2ccc(CO)cn2)cnc1N)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol?
The InChIKey is YBBZPSPBLNETEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl2FN3O2/c1-10(17-13(20)3-4-14(22)18(17)21)27-16-6-12(8-25-19(16)23)15-5-2-11(9-26)7-24-15/h2-8,10,26H,9H2,1H3,(H2,23,25).
What are the key properties of [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol?
[6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol has a molecular weight of 408.26 g/mol, XLogP of 4.80, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-3-pyridinyl]methanol is sourced from PubChem (CID 58688145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).