C21H22F3N5O2 — CID 58688768
5-(isocyanomethyl)-N-methyl-N-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]pyrazin-2-amine (PubChem CID 58688768) has the molecular formula C21H22F3N5O2 and a molecular weight of 433.43 g/mol. Its IUPAC name is 5-(isocyanomethyl)-N-methyl-N-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]pyrazin-2-amine.
| Compound Name | 5-(isocyanomethyl)-N-methyl-N-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 58688768 |
| Molecular Formula | C21H22F3N5O2 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 5-(isocyanomethyl)-N-methyl-N-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]pyrazin-2-amine |
| SMILES | [C-]#[N+]Cc1cnc(N(C)CCCOc2ccc3c(C(F)(F)F)noc3c2CCC)cn1 |
| InChI | InChI=1S/C21H22F3N5O2/c1-4-6-15-17(8-7-16-19(15)31-28-20(16)21(22,23)24)30-10-5-9-29(3)18-13-26-14(11-25-2)12-27-18/h7-8,12-13H,4-6,9-11H2,1,3H3 |
| InChIKey | PADRTVOARQPYQP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|