C20H21F3N4O2S — CID 58688810
5-(isocyanomethyl)-N-methyl-N-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-thiazol-2-amine (PubChem CID 58688810) has the molecular formula C20H21F3N4O2S and a molecular weight of 438.48 g/mol. Its IUPAC name is 5-(isocyanomethyl)-N-methyl-N-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-thiazol-2-amine.
| Compound Name | 5-(isocyanomethyl)-N-methyl-N-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58688810 |
| Molecular Formula | C20H21F3N4O2S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 5-(isocyanomethyl)-N-methyl-N-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-1,3-thiazol-2-amine |
| SMILES | [C-]#[N+]Cc1cnc(N(C)CCCOc2ccc3c(C(F)(F)F)noc3c2CCC)s1 |
| InChI | InChI=1S/C20H21F3N4O2S/c1-4-6-14-16(8-7-15-17(14)29-26-18(15)20(21,22)23)28-10-5-9-27(3)19-25-12-13(30-19)11-24-2/h7-8,12H,4-6,9-11H2,1,3H3 |
| InChIKey | IGADKHIMVKYEQH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|