C18H29P3 — CID 58698004
bis[[(1S,2R)-1-methylphospholan-2-yl]methyl]-phenylphosphane (PubChem CID 58698004) has the molecular formula C18H29P3 and a molecular weight of 338.35 g/mol. Its IUPAC name is bis[[(1S,2R)-1-methylphospholan-2-yl]methyl]-phenylphosphane.
| Compound Name | bis[[(1S,2R)-1-methylphospholan-2-yl]methyl]-phenylphosphane |
|---|---|
| PubChem CID | 58698004 |
| Molecular Formula | C18H29P3 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | bis[[(1S,2R)-1-methylphospholan-2-yl]methyl]-phenylphosphane |
| SMILES | C[P@@]1CCC[C@@H]1CP(C[C@H]1CCC[P@]1C)c1ccccc1 |
| InChI | InChI=1S/C18H29P3/c1-19-12-6-10-17(19)14-21(16-8-4-3-5-9-16)15-18-11-7-13-20(18)2/h3-5,8-9,17-18H,6-7,10-15H2,1-2H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | BLQOUBPHNWVVHG-ZRNYENFQSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|