C19H24P2 — CID 44609097
2-[(1S,2R)-1-methylphospholan-2-yl]ethyl-diphenylphosphane (PubChem CID 44609097) has the molecular formula C19H24P2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-[(1S,2R)-1-methylphospholan-2-yl]ethyl-diphenylphosphane.
| Compound Name | 2-[(1S,2R)-1-methylphospholan-2-yl]ethyl-diphenylphosphane |
|---|---|
| PubChem CID | 44609097 |
| Molecular Formula | C19H24P2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-[(1S,2R)-1-methylphospholan-2-yl]ethyl-diphenylphosphane |
| SMILES | C[P@@]1CCC[C@@H]1CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24P2/c1-20-15-8-13-17(20)14-16-21(18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-7,9-12,17H,8,13-16H2,1H3/t17-,20+/m1/s1 |
| InChIKey | ZSCKXESQPAMJIK-XLIONFOSSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|