C14H20BP — CID 173497582
CID 173497582 (PubChem CID 173497582) has the molecular formula C14H20BP and a molecular weight of 230.10 g/mol.
| Compound Name | CID 173497582 |
|---|---|
| PubChem CID | 173497582 |
| Molecular Formula | C14H20BP |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | — |
| SMILES | [B]C[C@@H](C)C[C@H]1CCC[P@@]1c1ccccc1 |
| InChI | InChI=1S/C14H20BP/c1-12(11-15)10-14-8-5-9-16(14)13-6-3-2-4-7-13/h2-4,6-7,12,14H,5,8-11H2,1H3/t12-,14+,16-/m0/s1 |
| InChIKey | SEZPGUPNDMZPEQ-BJJXKVORSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|