C50H56B2P4+2 — CID 159916360
CID 159916360 (PubChem CID 159916360) has the molecular formula C50H56B2P4+2 and a molecular weight of 802.52 g/mol.
| Compound Name | CID 159916360 |
|---|---|
| PubChem CID | 159916360 |
| Molecular Formula | C50H56B2P4+2 |
| Molecular Weight | 802.52 g/mol |
| Exact Mass | 802.35 |
| IUPAC Name | — |
| SMILES | C[C@H](C[C@H]1CCC[P@@]1c1ccccc1)P(c1ccccc1)c1ccccc1.[B][P+]1(c2ccccc2)CCC[C@@H]1C[C@@H](C)[P+]([B])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28B2P2.C25H28P2/c1-21(20-25-18-11-19-28(25,26)22-12-5-2-6-13-22)29(27,23-14-7-3-8-15-23)24-16-9-4-10-17-24;1-21(20-25-18-11-19-26(25)22-12-5-2-6-13-22)27(23-14-7-3-8-15-23)24-16-9-4-10-17-24/h2-10,12-17,21,25H,11,18-20H2,1H3;2-10,12-17,21,25H,11,18-20H2,1H3/q+2;/t21-,25-,28?;21-,25-,26+/m11/s1 |
| InChIKey | VDOMHVNDFDTEOV-VWDGAWJWSA-N |
| XLogP | 10.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.52 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|