C33H36P2 — CID 90110759
1,2-diphenylphospholane;2-methyl-1,2-diphenylphospholane (PubChem CID 90110759) has the molecular formula C33H36P2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 1,2-diphenylphospholane;2-methyl-1,2-diphenylphospholane.
| Compound Name | 1,2-diphenylphospholane;2-methyl-1,2-diphenylphospholane |
|---|---|
| PubChem CID | 90110759 |
| Molecular Formula | C33H36P2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 1,2-diphenylphospholane;2-methyl-1,2-diphenylphospholane |
| SMILES | CC1(c2ccccc2)CCCP1c1ccccc1.c1ccc(C2CCCP2c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19P.C16H17P/c1-17(15-9-4-2-5-10-15)13-8-14-18(17)16-11-6-3-7-12-16;1-3-8-14(9-4-1)16-12-7-13-17(16)15-10-5-2-6-11-15/h2-7,9-12H,8,13-14H2,1H3;1-6,8-11,16H,7,12-13H2 |
| InChIKey | JACLUOCSBHWJHR-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|