C16H17OP — CID 23414358
(2R,3S)-2,3-diphenyl-1,3-oxaphosphinane (PubChem CID 23414358) has the molecular formula C16H17OP and a molecular weight of 256.29 g/mol. Its IUPAC name is (2R,3S)-2,3-diphenyl-1,3-oxaphosphinane.
| Compound Name | (2R,3S)-2,3-diphenyl-1,3-oxaphosphinane |
|---|---|
| PubChem CID | 23414358 |
| Molecular Formula | C16H17OP |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (2R,3S)-2,3-diphenyl-1,3-oxaphosphinane |
| SMILES | c1ccc([C@@H]2OCCC[P@@]2c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17OP/c1-3-8-14(9-4-1)16-17-12-7-13-18(16)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13H2/t16-,18+/m1/s1 |
| InChIKey | RIPQHNYIANPZLR-AEFFLSMTSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|