C18H23N3O3W — CID 58703275
(1-methyl-2H-indol-2-id-3-yl)methyl-[3-(oxan-2-yloxyamino)-3-oxopropyl]azanide;tungsten(2+) (PubChem CID 58703275) has the molecular formula C18H23N3O3W and a molecular weight of 513.24 g/mol. Its IUPAC name is (1-methyl-2H-indol-2-id-3-yl)methyl-[3-(oxan-2-yloxyamino)-3-oxopropyl]azanide;tungsten(2+).
| Compound Name | (1-methyl-2H-indol-2-id-3-yl)methyl-[3-(oxan-2-yloxyamino)-3-oxopropyl]azanide;tungsten(2+) |
|---|---|
| PubChem CID | 58703275 |
| Molecular Formula | C18H23N3O3W |
| Molecular Weight | 513.24 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | (1-methyl-2H-indol-2-id-3-yl)methyl-[3-(oxan-2-yloxyamino)-3-oxopropyl]azanide;tungsten(2+) |
| SMILES | Cn1[c-]c(C[N-]CCC(=O)NOC2CCCCO2)c2ccccc21.[W+2] |
| InChI | InChI=1S/C18H23N3O3.W/c1-21-13-14(15-6-2-3-7-16(15)21)12-19-10-9-17(22)20-24-18-8-4-5-11-23-18;/h2-3,6-7,18H,4-5,8-12H2,1H3,(H,20,22);/q-2;+2 |
| InChIKey | QNNCXZFVEBSLQQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|