C17H21N3O3W — CID 58703285
1,2-dihydroindol-2-id-3-ylmethyl-[3-(oxan-2-yloxyamino)-3-oxopropyl]azanide;tungsten(2+) (PubChem CID 58703285) has the molecular formula C17H21N3O3W and a molecular weight of 499.21 g/mol. Its IUPAC name is 1,2-dihydroindol-2-id-3-ylmethyl-[3-(oxan-2-yloxyamino)-3-oxopropyl]azanide;tungsten(2+).
| Compound Name | 1,2-dihydroindol-2-id-3-ylmethyl-[3-(oxan-2-yloxyamino)-3-oxopropyl]azanide;tungsten(2+) |
|---|---|
| PubChem CID | 58703285 |
| Molecular Formula | C17H21N3O3W |
| Molecular Weight | 499.21 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 1,2-dihydroindol-2-id-3-ylmethyl-[3-(oxan-2-yloxyamino)-3-oxopropyl]azanide;tungsten(2+) |
| SMILES | O=C(CC[N-]Cc1[c-][nH]c2ccccc12)NOC1CCCCO1.[W+2] |
| InChI | InChI=1S/C17H21N3O3.W/c21-16(20-23-17-7-3-4-10-22-17)8-9-18-11-13-12-19-15-6-2-1-5-14(13)15;/h1-2,5-6,17,19H,3-4,7-11H2,(H,20,21);/q-2;+2 |
| InChIKey | RWTVXXZEVXQXDV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|