C27H42F3N2O8PS — CID 58703930
3-[5-[6-methoxyhexoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-3,3-dimethyl-2-methylideneindol-1-yl]propane-1-sulfonic acid (PubChem CID 58703930) has the molecular formula C27H42F3N2O8PS and a molecular weight of 642.67 g/mol. Its IUPAC name is 3-[5-[6-methoxyhexoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-3,3-dimethyl-2-methylideneindol-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-[6-methoxyhexoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-3,3-dimethyl-2-methylideneindol-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58703930 |
| Molecular Formula | C27H42F3N2O8PS |
| Molecular Weight | 642.67 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 3-[5-[6-methoxyhexoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-3,3-dimethyl-2-methylideneindol-1-yl]propane-1-sulfonic acid |
| SMILES | C=C1N(CCCS(=O)(=O)O)c2ccc(P(=O)(OCCCCCCOC)OCCCCNC(=O)C(F)(F)F)cc2C1(C)C |
| InChI | InChI=1S/C27H42F3N2O8PS/c1-21-26(2,3)23-20-22(12-13-24(23)32(21)15-11-19-42(35,36)37)41(34,39-17-9-6-5-8-16-38-4)40-18-10-7-14-31-25(33)27(28,29)30/h12-13,20H,1,5-11,14-19H2,2-4H3,(H,31,33)(H,35,36,37) |
| InChIKey | CIDHMRDUOCQJGI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|