C48H42N4O6 — CID 58709362
1-[4,5-diphenyl-2-(2,4,6-trimethoxyphenyl)imidazol-2-yl]-4,5-diphenyl-2-(2,4,6-trimethoxyphenyl)imidazole (PubChem CID 58709362) has the molecular formula C48H42N4O6 and a molecular weight of 770.89 g/mol. Its IUPAC name is 1-[4,5-diphenyl-2-(2,4,6-trimethoxyphenyl)imidazol-2-yl]-4,5-diphenyl-2-(2,4,6-trimethoxyphenyl)imidazole.
| Compound Name | 1-[4,5-diphenyl-2-(2,4,6-trimethoxyphenyl)imidazol-2-yl]-4,5-diphenyl-2-(2,4,6-trimethoxyphenyl)imidazole |
|---|---|
| PubChem CID | 58709362 |
| Molecular Formula | C48H42N4O6 |
| Molecular Weight | 770.89 g/mol |
| Exact Mass | 770.31 |
| IUPAC Name | 1-[4,5-diphenyl-2-(2,4,6-trimethoxyphenyl)imidazol-2-yl]-4,5-diphenyl-2-(2,4,6-trimethoxyphenyl)imidazole |
| SMILES | COc1cc(OC)c(-c2nc(-c3ccccc3)c(-c3ccccc3)n2C2(c3c(OC)cc(OC)cc3OC)N=C(c3ccccc3)C(c3ccccc3)=N2)c(OC)c1 |
| InChI | InChI=1S/C48H42N4O6/c1-53-35-27-37(55-3)41(38(28-35)56-4)47-49-45(33-23-15-9-16-24-33)46(34-25-17-10-18-26-34)52(47)48(42-39(57-5)29-36(54-2)30-40(42)58-6)50-43(31-19-11-7-12-20-31)44(51-48)32-21-13-8-14-22-32/h7-30H,1-6H3 |
| InChIKey | RYHFITQMHVPYMF-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 97.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.89 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |