C30H23N3O2 — CID 139235828
5-(3,5-dimethoxyphenyl)-2,3-diphenylimidazo[1,2-c]quinazoline (PubChem CID 139235828) has the molecular formula C30H23N3O2 and a molecular weight of 457.53 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenyl)-2,3-diphenylimidazo[1,2-c]quinazoline.
| Compound Name | 5-(3,5-dimethoxyphenyl)-2,3-diphenylimidazo[1,2-c]quinazoline |
|---|---|
| PubChem CID | 139235828 |
| Molecular Formula | C30H23N3O2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 5-(3,5-dimethoxyphenyl)-2,3-diphenylimidazo[1,2-c]quinazoline |
| SMILES | COc1cc(OC)cc(-c2nc3ccccc3c3nc(-c4ccccc4)c(-c4ccccc4)n23)c1 |
| InChI | InChI=1S/C30H23N3O2/c1-34-23-17-22(18-24(19-23)35-2)29-31-26-16-10-9-15-25(26)30-32-27(20-11-5-3-6-12-20)28(33(29)30)21-13-7-4-8-14-21/h3-19H,1-2H3 |
| InChIKey | DLNQODIQHSAUMS-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |