C30H61NO3SSi2 — CID 58711679
(2S,3S)-3-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-1-[S-tert-butyl-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]butan-2-ol (PubChem CID 58711679) has the molecular formula C30H61NO3SSi2 and a molecular weight of 572.06 g/mol. Its IUPAC name is (2S,3S)-3-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-1-[S-tert-butyl-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]butan-2-ol.
| Compound Name | (2S,3S)-3-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-1-[S-tert-butyl-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]butan-2-ol |
|---|---|
| PubChem CID | 58711679 |
| Molecular Formula | C30H61NO3SSi2 |
| Molecular Weight | 572.06 g/mol |
| Exact Mass | 571.39 |
| IUPAC Name | (2S,3S)-3-[(3aR,4S,7aS)-7a-methyl-4-triethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-1-[S-tert-butyl-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]butan-2-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)C([C@H](C)[C@H](O)C[S@@](=O)(=N[Si](C)(C)C(C)(C)C)C(C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C30H61NO3SSi2/c1-14-37(15-2,16-3)34-27-18-17-21-30(11)24(19-20-25(27)30)23(4)26(32)22-35(33,28(5,6)7)31-36(12,13)29(8,9)10/h19,23,25-27,32H,14-18,20-22H2,1-13H3/t23-,25-,26+,27-,30+,35-/m0/s1 |
| InChIKey | KMLKYMAWBKWNOY-RQQBDAAQSA-N |
| XLogP | 8.78 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.06 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|