C30H61NO2SSi2 — CID 90943554
(3aS,7S,7aR)-3-[(2R)-4-[tert-butyl-[[tert-butyl(dimethyl)silyl]amino]-oxo-λ6-sulfanylidene]butan-2-yl]-3a-methyl-7-triethylsilyloxy-1,4,5,6,7,7a-hexahydroindene (PubChem CID 90943554) has the molecular formula C30H61NO2SSi2 and a molecular weight of 556.06 g/mol. Its IUPAC name is (3aS,7S,7aR)-3-[(2R)-4-[tert-butyl-[[tert-butyl(dimethyl)silyl]amino]-oxo-λ6-sulfanylidene]butan-2-yl]-3a-methyl-7-triethylsilyloxy-1,4,5,6,7,7a-hexahydroindene.
| Compound Name | (3aS,7S,7aR)-3-[(2R)-4-[tert-butyl-[[tert-butyl(dimethyl)silyl]amino]-oxo-λ6-sulfanylidene]butan-2-yl]-3a-methyl-7-triethylsilyloxy-1,4,5,6,7,7a-hexahydroindene |
|---|---|
| PubChem CID | 90943554 |
| Molecular Formula | C30H61NO2SSi2 |
| Molecular Weight | 556.06 g/mol |
| Exact Mass | 555.40 |
| IUPAC Name | (3aS,7S,7aR)-3-[(2R)-4-[tert-butyl-[[tert-butyl(dimethyl)silyl]amino]-oxo-λ6-sulfanylidene]butan-2-yl]-3a-methyl-7-triethylsilyloxy-1,4,5,6,7,7a-hexahydroindene |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)C([C@H](C)CC=S(=O)(N[Si](C)(C)C(C)(C)C)C(C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C30H61NO2SSi2/c1-14-36(15-2,16-3)33-27-18-17-22-30(11)25(19-20-26(27)30)24(4)21-23-34(32,28(5,6)7)31-35(12,13)29(8,9)10/h19,23-24,26-27H,14-18,20-22H2,1-13H3,(H,31,32)/t24-,26+,27+,30-,34?/m1/s1 |
| InChIKey | RAYVMJXIGUVEQM-HPSYBPFYSA-N |
| XLogP | 8.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.06 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|