C25H46O3SSi — CID 10575721
[(3aR,4S,7aS)-1-[(E,2R)-5-tert-butylsulfonylpent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane (PubChem CID 10575721) has the molecular formula C25H46O3SSi and a molecular weight of 454.79 g/mol. Its IUPAC name is [(3aR,4S,7aS)-1-[(E,2R)-5-tert-butylsulfonylpent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane.
| Compound Name | [(3aR,4S,7aS)-1-[(E,2R)-5-tert-butylsulfonylpent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 10575721 |
| Molecular Formula | C25H46O3SSi |
| Molecular Weight | 454.79 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | [(3aR,4S,7aS)-1-[(E,2R)-5-tert-butylsulfonylpent-4-en-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)C([C@H](C)C/C=C/S(=O)(=O)C(C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C25H46O3SSi/c1-9-30(10-2,11-3)28-23-15-12-18-25(8)21(16-17-22(23)25)20(4)14-13-19-29(26,27)24(5,6)7/h13,16,19-20,22-23H,9-12,14-15,17-18H2,1-8H3/b19-13+/t20-,22+,23+,25-/m1/s1 |
| InChIKey | BBVFUHZRRBYUOV-PFMKLPMASA-N |
| XLogP | 7.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.79 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|