C25H46O3SSi — CID 134981893
tert-butyl (1E,3E)-4-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-methylbuta-1,3-diene-1-sulfinate (PubChem CID 134981893) has the molecular formula C25H46O3SSi and a molecular weight of 454.79 g/mol. Its IUPAC name is tert-butyl (1E,3E)-4-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-methylbuta-1,3-diene-1-sulfinate.
| Compound Name | tert-butyl (1E,3E)-4-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-methylbuta-1,3-diene-1-sulfinate |
|---|---|
| PubChem CID | 134981893 |
| Molecular Formula | C25H46O3SSi |
| Molecular Weight | 454.79 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | tert-butyl (1E,3E)-4-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-methylbuta-1,3-diene-1-sulfinate |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)[C@@H](/C=C(C)/C=C/S(=O)OC(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C25H46O3SSi/c1-9-30(10-2,11-3)27-23-13-12-17-25(8)21(14-15-22(23)25)19-20(4)16-18-29(26)28-24(5,6)7/h16,18-19,21-23H,9-15,17H2,1-8H3/b18-16+,20-19+/t21-,22+,23+,25-,29?/m1/s1 |
| InChIKey | YBITWAXZWDXVOJ-FNAWQEBHSA-N |
| XLogP | 7.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.79 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|