C11H11IN4O2S — CID 58712573
1-[5-(4-iodoanilino)-3-oxo-1,2-thiazol-4-yl]-3-methylurea (PubChem CID 58712573) has the molecular formula C11H11IN4O2S and a molecular weight of 390.21 g/mol. Its IUPAC name is 1-[5-(4-iodoanilino)-3-oxo-1,2-thiazol-4-yl]-3-methylurea.
| Compound Name | 1-[5-(4-iodoanilino)-3-oxo-1,2-thiazol-4-yl]-3-methylurea |
|---|---|
| PubChem CID | 58712573 |
| Molecular Formula | C11H11IN4O2S |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 1-[5-(4-iodoanilino)-3-oxo-1,2-thiazol-4-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1c(Nc2ccc(I)cc2)s[nH]c1=O |
| InChI | InChI=1S/C11H11IN4O2S/c1-13-11(18)15-8-9(17)16-19-10(8)14-7-4-2-6(12)3-5-7/h2-5,14H,1H3,(H,16,17)(H2,13,15,18) |
| InChIKey | CPZJWWDMKAEMJH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|