C12H14N6O2 — CID 70612463
1-[4-[(5-amino-6-oxo-1H-pyrimidin-2-yl)amino]phenyl]-3-methylurea (PubChem CID 70612463) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-[4-[(5-amino-6-oxo-1H-pyrimidin-2-yl)amino]phenyl]-3-methylurea.
| Compound Name | 1-[4-[(5-amino-6-oxo-1H-pyrimidin-2-yl)amino]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 70612463 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-[4-[(5-amino-6-oxo-1H-pyrimidin-2-yl)amino]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(Nc2ncc(N)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C12H14N6O2/c1-14-12(20)17-8-4-2-7(3-5-8)16-11-15-6-9(13)10(19)18-11/h2-6H,13H2,1H3,(H2,14,17,20)(H2,15,16,18,19) |
| InChIKey | IBSXOPMUEFVMEM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |