C19H31BFNNiO2 — CID 58715155
CID 58715155 (PubChem CID 58715155) has the molecular formula C19H31BFNNiO2 and a molecular weight of 393.97 g/mol.
| Compound Name | CID 58715155 |
|---|---|
| PubChem CID | 58715155 |
| Molecular Formula | C19H31BFNNiO2 |
| Molecular Weight | 393.97 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | — |
| SMILES | C/C(=N\c1c(C(C)C)cccc1C(C)C)C(=O)O[B]CF.[CH3-].[CH3-].[CH3-].[Ni+3] |
| InChI | InChI=1S/C16H22BFNO2.3CH3.Ni/c1-10(2)13-7-6-8-14(11(3)4)15(13)19-12(5)16(20)21-17-9-18;;;;/h6-8,10-11H,9H2,1-5H3;3*1H3;/q;3*-1;+3/b19-12+;;;; |
| InChIKey | FPNXXSCUHMOPQY-KRYKKDAZSA-N |
| XLogP | 5.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.97 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|