About 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one
4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one (PubChem CID 58725743) has the molecular formula C5HF7O3
and a molecular weight of 242.05 g/mol. Its IUPAC name is 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one.
Analyze 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one?
The IUPAC name of 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one (CID 58725743) is 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one.
What is the SMILES notation for 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one?
The canonical SMILES for 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one is O=C1OC(C(F)(F)F)C(F)(C(F)(F)F)O1.
What is the InChIKey of 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one?
The InChIKey is MGSHRKLDGALLAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HF7O3/c6-3(5(10,11)12)1(4(7,8)9)14-2(13)15-3/h1H.
What are the key properties of 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one?
4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one has a molecular weight of 242.05 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-4,5-bis(trifluoromethyl)-1,3-dioxolan-2-one is sourced from PubChem (CID 58725743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).