C7H3F9O3 — CID 112758214
4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1,3-dioxolan-2-one (PubChem CID 112758214) has the molecular formula C7H3F9O3 and a molecular weight of 306.08 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 112758214 |
| Molecular Formula | C7H3F9O3 |
| Molecular Weight | 306.08 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C7H3F9O3/c8-4(9,2-1-18-3(17)19-2)5(10,11)6(12,13)7(14,15)16/h2H,1H2 |
| InChIKey | PHNKFQLUMVJFOV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.08 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|