About 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one
4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one (PubChem CID 59863818) has the molecular formula C4HF5O3
and a molecular weight of 192.04 g/mol. Its IUPAC name is 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one.
Analyze 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one?
The IUPAC name of 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one (CID 59863818) is 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one.
What is the SMILES notation for 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one?
The canonical SMILES for 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one is O=C1OC(C(F)(F)F)C(F)(F)O1.
What is the InChIKey of 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one?
The InChIKey is PCGCMHWCIAZBCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HF5O3/c5-3(6,7)1-4(8,9)12-2(10)11-1/h1H.
What are the key properties of 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one?
4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one has a molecular weight of 192.04 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-5-(trifluoromethyl)-1,3-dioxolan-2-one is sourced from PubChem (CID 59863818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).