C9H3F13O3 — CID 13278452
4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-dioxolan-2-one (PubChem CID 13278452) has the molecular formula C9H3F13O3 and a molecular weight of 406.09 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 13278452 |
| Molecular Formula | C9H3F13O3 |
| Molecular Weight | 406.09 g/mol |
| Exact Mass | 405.99 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C9H3F13O3/c10-4(11,2-1-24-3(23)25-2)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h2H,1H2 |
| InChIKey | AYBYNOCNPHROFT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.09 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|