C17H16BrN3O — CID 58727026
3-bromo-N-[2-(3H-isoindol-1-ylamino)ethyl]benzamide (PubChem CID 58727026) has the molecular formula C17H16BrN3O and a molecular weight of 358.24 g/mol. Its IUPAC name is 3-bromo-N-[2-(3H-isoindol-1-ylamino)ethyl]benzamide.
| Compound Name | 3-bromo-N-[2-(3H-isoindol-1-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 58727026 |
| Molecular Formula | C17H16BrN3O |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 3-bromo-N-[2-(3H-isoindol-1-ylamino)ethyl]benzamide |
| SMILES | O=C(NCCNC1=NCc2ccccc21)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H16BrN3O/c18-14-6-3-5-12(10-14)17(22)20-9-8-19-16-15-7-2-1-4-13(15)11-21-16/h1-7,10H,8-9,11H2,(H,19,21)(H,20,22) |
| InChIKey | RQBWYEDFMCZKIF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|