C11H16NO3Rb — CID 58730962
CID 58730962 (PubChem CID 58730962) has the molecular formula C11H16NO3Rb and a molecular weight of 295.72 g/mol.
| Compound Name | CID 58730962 |
|---|---|
| PubChem CID | 58730962 |
| Molecular Formula | C11H16NO3Rb |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | — |
| SMILES | COC(=O)C1C(=O)CC2C[CH-]CC1N2C.[Rb+] |
| InChI | InChI=1S/C11H16NO3.Rb/c1-12-7-4-3-5-8(12)10(9(13)6-7)11(14)15-2;/h3,7-8,10H,4-6H2,1-2H3;/q-1;+1 |
| InChIKey | UIEKIELRYWQYBU-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|