C11H17NO4 — CID 50937390
methyl (1R,2S,4R,5S)-4-(hydroxymethyl)-8-methyl-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 50937390) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl (1R,2S,4R,5S)-4-(hydroxymethyl)-8-methyl-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2S,4R,5S)-4-(hydroxymethyl)-8-methyl-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 50937390 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | methyl (1R,2S,4R,5S)-4-(hydroxymethyl)-8-methyl-3-oxo-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)[C@@H](CO)[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C11H17NO4/c1-12-7-3-4-8(12)9(11(15)16-2)10(14)6(7)5-13/h6-9,13H,3-5H2,1-2H3/t6-,7-,8+,9-/m0/s1 |
| InChIKey | MFTUJDKAJJIAPZ-MAUMQABQSA-N |
| XLogP | -0.57 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|