C9H24N7P2+ — CID 58734225
tris(methylideneamino)-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium (PubChem CID 58734225) has the molecular formula C9H24N7P2+ and a molecular weight of 292.29 g/mol. Its IUPAC name is tris(methylideneamino)-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium.
| Compound Name | tris(methylideneamino)-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium |
|---|---|
| PubChem CID | 58734225 |
| Molecular Formula | C9H24N7P2+ |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | tris(methylideneamino)-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium |
| SMILES | C=N[P+](N=C)(N=C)N=P(N(C)C)(N(C)C)N(C)C |
| InChI | InChI=1S/C9H24N7P2/c1-10-17(11-2,12-3)13-18(14(4)5,15(6)7)16(8)9/h1-3H2,4-9H3/q+1 |
| InChIKey | ZCNZBSFLHTXGOO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|