About [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium
[bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium (PubChem CID 164764518) has the molecular formula C13H39N7P2+2
and a molecular weight of 355.45 g/mol. Its IUPAC name is [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium.
Molecular Properties
| Compound Name | [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium |
| PubChem CID | 164764518 |
| Molecular Formula | C13H39N7P2+2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium |
| SMILES | CN(C)P(=N[P+](N(C)C)(N(C)C)N(C)C)(N(C)C)[N+](C)(C)C |
| InChI | InChI=1S/C13H39N7P2/c1-15(2)21(16(3)4,17(5)6)14-22(18(7)8,19(9)10)20(11,12)13/h1-13H3/q+2 |
| InChIKey | XUIZXSWYDVWESW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 28.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium?
The IUPAC name of [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium (CID 164764518) is [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium.
What is the SMILES notation for [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium?
The canonical SMILES for [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium is CN(C)P(=N[P+](N(C)C)(N(C)C)N(C)C)(N(C)C)[N+](C)(C)C.
What is the InChIKey of [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium?
The InChIKey is XUIZXSWYDVWESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H39N7P2/c1-15(2)21(16(3)4,17(5)6)14-22(18(7)8,19(9)10)20(11,12)13/h1-13H3/q+2.
What are the key properties of [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium?
[bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium has a molecular weight of 355.45 g/mol, XLogP of 2.12, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium is sourced from PubChem (CID 164764518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).