C13H39N7P2+2 — CID 164764518
[bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium (PubChem CID 164764518) has the molecular formula C13H39N7P2+2 and a molecular weight of 355.45 g/mol. Its IUPAC name is [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium.
| Compound Name | [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium |
|---|---|
| PubChem CID | 164764518 |
| Molecular Formula | C13H39N7P2+2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | [bis(dimethylamino)-[tris(dimethylamino)phosphaniumylimino]-λ5-phosphanyl]-trimethylazanium |
| SMILES | CN(C)P(=N[P+](N(C)C)(N(C)C)N(C)C)(N(C)C)[N+](C)(C)C |
| InChI | InChI=1S/C13H39N7P2/c1-15(2)21(16(3)4,17(5)6)14-22(18(7)8,19(9)10)20(11,12)13/h1-13H3/q+2 |
| InChIKey | XUIZXSWYDVWESW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 28.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|