About tetrakis(dimethylamino)phosphanium;zirconium(4+)
tetrakis(dimethylamino)phosphanium;zirconium(4+) (PubChem CID 175871250) has the molecular formula C8H24N4PZr+5
and a molecular weight of 298.51 g/mol. Its IUPAC name is tetrakis(dimethylamino)phosphanium;zirconium(4+).
Molecular Properties
| Compound Name | tetrakis(dimethylamino)phosphanium;zirconium(4+) |
| PubChem CID | 175871250 |
| Molecular Formula | C8H24N4PZr+5 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | tetrakis(dimethylamino)phosphanium;zirconium(4+) |
| SMILES | CN(C)[P+](N(C)C)(N(C)C)N(C)C.[Zr+4] |
| InChI | InChI=1S/C8H24N4P.Zr/c1-9(2)13(10(3)4,11(5)6)12(7)8;/h1-8H3;/q+1;+4 |
| InChIKey | OXZHCFWKYNPKLK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(dimethylamino)phosphanium;zirconium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(dimethylamino)phosphanium;zirconium(4+)?
The IUPAC name of tetrakis(dimethylamino)phosphanium;zirconium(4+) (CID 175871250) is tetrakis(dimethylamino)phosphanium;zirconium(4+).
What is the SMILES notation for tetrakis(dimethylamino)phosphanium;zirconium(4+)?
The canonical SMILES for tetrakis(dimethylamino)phosphanium;zirconium(4+) is CN(C)[P+](N(C)C)(N(C)C)N(C)C.[Zr+4].
What is the InChIKey of tetrakis(dimethylamino)phosphanium;zirconium(4+)?
The InChIKey is OXZHCFWKYNPKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H24N4P.Zr/c1-9(2)13(10(3)4,11(5)6)12(7)8;/h1-8H3;/q+1;+4.
What are the key properties of tetrakis(dimethylamino)phosphanium;zirconium(4+)?
tetrakis(dimethylamino)phosphanium;zirconium(4+) has a molecular weight of 298.51 g/mol, XLogP of 0.91, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(dimethylamino)phosphanium;zirconium(4+) is sourced from PubChem (CID 175871250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).