C11H33N6P2+ — CID 163707582
bis(dimethylamino)-methyl-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium (PubChem CID 163707582) has the molecular formula C11H33N6P2+ and a molecular weight of 311.38 g/mol. Its IUPAC name is bis(dimethylamino)-methyl-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium.
| Compound Name | bis(dimethylamino)-methyl-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium |
|---|---|
| PubChem CID | 163707582 |
| Molecular Formula | C11H33N6P2+ |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | bis(dimethylamino)-methyl-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium |
| SMILES | CN(C)P(=N[P+](C)(N(C)C)N(C)C)(N(C)C)N(C)C |
| InChI | InChI=1S/C11H33N6P2/c1-13(2)18(11,14(3)4)12-19(15(5)6,16(7)8)17(9)10/h1-11H3/q+1 |
| InChIKey | OOCQGACTGKHTBL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 28.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|