C21H30O4 — CID 58734400
2-[5-(hydroxymethyl)oxolan-2-yl]propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 58734400) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-[5-(hydroxymethyl)oxolan-2-yl]propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | 2-[5-(hydroxymethyl)oxolan-2-yl]propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 58734400 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2-[5-(hydroxymethyl)oxolan-2-yl]propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CC(C)(OC(=O)C1CC2CC1C1C3C=CC(C3)C21)C1CCC(CO)O1 |
| InChI | InChI=1S/C21H30O4/c1-21(2,17-6-5-14(10-22)24-17)25-20(23)16-9-13-8-15(16)19-12-4-3-11(7-12)18(13)19/h3-4,11-19,22H,5-10H2,1-2H3 |
| InChIKey | CQWORWCJDGTRCS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|