C17H22F2O3 — CID 70992435
(1,1-difluoro-3-hydroxy-2-methylpropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 70992435) has the molecular formula C17H22F2O3 and a molecular weight of 312.36 g/mol. Its IUPAC name is (1,1-difluoro-3-hydroxy-2-methylpropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | (1,1-difluoro-3-hydroxy-2-methylpropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 70992435 |
| Molecular Formula | C17H22F2O3 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (1,1-difluoro-3-hydroxy-2-methylpropan-2-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CC(CO)(OC(=O)C1CC2CC1C1C3C=CC(C3)C21)C(F)F |
| InChI | InChI=1S/C17H22F2O3/c1-17(7-20,16(18)19)22-15(21)12-6-10-5-11(12)14-9-3-2-8(4-9)13(10)14/h2-3,8-14,16,20H,4-7H2,1H3 |
| InChIKey | ZOLMNULWYFRHCU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|