C18H23O5S- — CID 58734748
1-adamantylmethyl (3Z)-2-methylidene-5-oxidoperoxysulfanylhexa-3,5-dienoate (PubChem CID 58734748) has the molecular formula C18H23O5S- and a molecular weight of 351.44 g/mol. Its IUPAC name is 1-adamantylmethyl (3Z)-2-methylidene-5-oxidoperoxysulfanylhexa-3,5-dienoate.
| Compound Name | 1-adamantylmethyl (3Z)-2-methylidene-5-oxidoperoxysulfanylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 58734748 |
| Molecular Formula | C18H23O5S- |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-adamantylmethyl (3Z)-2-methylidene-5-oxidoperoxysulfanylhexa-3,5-dienoate |
| SMILES | C=C(/C=C\C(=C)C(=O)OCC12CC3CC(CC(C3)C1)C2)SOO[O-] |
| InChI | InChI=1S/C18H24O5S/c1-12(3-4-13(2)24-23-22-20)17(19)21-11-18-8-14-5-15(9-18)7-16(6-14)10-18/h3-4,14-16,20H,1-2,5-11H2/p-1/b4-3- |
| InChIKey | NECRNJNZYITFIO-ARJAWSKDSA-M |
| XLogP | 3.24 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|