C19H23NO9S2 — CID 58737631
[2-[[3-[(3-sulfooxyphenoxy)methyl]piperidin-1-yl]methyl]phenyl] hydrogen sulfate (PubChem CID 58737631) has the molecular formula C19H23NO9S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is [2-[[3-[(3-sulfooxyphenoxy)methyl]piperidin-1-yl]methyl]phenyl] hydrogen sulfate.
| Compound Name | [2-[[3-[(3-sulfooxyphenoxy)methyl]piperidin-1-yl]methyl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 58737631 |
| Molecular Formula | C19H23NO9S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [2-[[3-[(3-sulfooxyphenoxy)methyl]piperidin-1-yl]methyl]phenyl] hydrogen sulfate |
| SMILES | O=S(=O)(O)Oc1cccc(OCC2CCCN(Cc3ccccc3OS(=O)(=O)O)C2)c1 |
| InChI | InChI=1S/C19H23NO9S2/c21-30(22,23)28-18-8-3-7-17(11-18)27-14-15-5-4-10-20(12-15)13-16-6-1-2-9-19(16)29-31(24,25)26/h1-3,6-9,11,15H,4-5,10,12-14H2,(H,21,22,23)(H,24,25,26) |
| InChIKey | BFMRRDNEVDNLFG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|